Suzhou Green Ness Plastic Co., Ltd

Stearic Acid: 1). CAS No.: 57-11-4 2).MF: C18H36O2 3). HS Code: 3823110000 4).Appearance: White flakes

Stearic Acid: 1). CAS No.: 57-11-4 2).MF: C18H36O2 3). HS Code: 3823110000 4).Appearance: White flakes

Adipic Acid: 1). Molecular Formula: C6H10O4 2). Molecular Weight: 146.14 3).Packing：25kg

Gum Rosin: 1. CAS No.: 8050-09-7 2. EINECS No.: 266-041-3 3. Other Names: Colophony 4. MF: C20H30O2

1. Name: PVC Resin (Polyvinyl Chloride Resin) HS CODE: 3904109001 CAS: 9002-86-2 MF: [-CH2-CHCl-]n Molecul

Gum Rosin: 1. CAS No.: 8050-09-7 2. EINECS No.: 266-041-3 3. Other Names: Colophony 4. MF: C20H30O2

Appearance : white plastic granules and transparent. Packing : 25 kg bag. 20MT/20;FCL Delivery time : we hav

Antimony Ingot: 1. other name: Stibium; Antimony 2. Packing: About 25kgs /Ingot, Packed in wooden case, Ne

Cerium Oxide: 1. Formula: CeO2 2. Molecular weight: 172.12 3. HS Code: 2846101000 4. CAS NO.: 1306-38-3

LDPE RESIN, Pellet type Specifications L-LDPE resin(TR):Industrial L-LDPE wrap film recycling by using 100-1

PVC Material Basic Info. Color: White Use: General Plastics Material: Polyvinyl Chloride/PVC Export

High-density polyethylene (HDPE) or polyethylene high-density (PEHD) is a polyethylene thermoplastic made from

1.Name: GAA, Acetic Acid, Glacial Acetic Acid HS Code: 29152110 CAS No.: 64-19-7 Formula: CH3COOH Purity:

Phosphoric Acid: 1.Einces No.: 231-633-2 2. MF: H3PO4 3. Packing: 35kg/drums, 25.2mt per 20’/

Phosphoric Acid: 1.Einces No.: 231-633-2 2. MF: H3PO4 3. Packing: 35kg/drums, 25.2mt per 20’/

Phosphoric Acid: 1.Einces No.: 231-633-2 2. MF: H3PO4 3. Packing: 35kg/drums, 25.2mt per 20’/

Phosphoric Acid: 1.Einces No.: 231-633-2 2. MF: H3PO4 3. Packing: 35kg/drums, 25.2mt per 20’/

Rongalite(Sodium hydrosulfite ) CAS No.: 7775-14-6 MF: Na2S2O4 EINECS No.: 231-890-0 Grade Standard: In

1.Product name: MPG(Mono Propylene Glycol) Purity: 99% 2.Appearance: Colorless liquid Molecular Formula:

Stearic Acid: 1. HS Code: 3823110000 2.CAS No.: 57-11-4 3.Packing: 25kg/pp bags and 25mt per 20â€

HS Code: 28364000 CAS No.: 67-56-1 EINECS: 200-659-6 MF.: CH3OH M.W: 32.04 Purity: 99% Appearants: colo

PCE: 1. HS Code: 2903230000 2.CAS NO.: 127-18-4 3.Purity: 99.5% 4.Packing: 300kg/ drum, 22MT/ 20'FC

MF: C24H38O4 CAS No.:117-81-7 H.S.Code : 2917.3200.00 EINECS No.: 204-211-0 Molecu

Purity: 99% Appearance: Colorless or yellowish liquid Molecular Formula: C11H25COO(CH2CH2O)nCOC11H25 Model

Chrome Oxide Green: 1.EINECS NO.: 215-160-9 2.CAS NO.: 1308-38-9 3.HS Code: 2819900000 4.Packing: 25kg/p

Properties: Colorless, transparent, odorless, viscous liquid, sweet, with moisture absorption. CAS: 56-81-5

1. Name: Phenol, Carbolic acid 2. Other name: phenyl hydroxide CAS NO: 108-95-2 Purity: 99.9% MF: C6H6O

Cyclohexanone Other name: CYC, anone 1. Purity: 99.5% 2. CAS NO.:108-94-1 3. Formula: C6H10O 4. Appea

DINP(Diisononyl phthalate) CAS NO: 28553-12-0 EC NO: 249-079-5 Purity: 99.6% Molecular Formula: C6H4(COOC9

1. White oil (Liquid Paraffin, Paraffin oil) 2. Best quality and most competitive price 3. Professional ser

Name: Polypropylene high quality PP. HS:3902100090 hardness and heat resistance Liquidity is good

1.Name: Adipic Acid (AA, Hexanedioic Acid) HS Code:30049090 CAS No: 124-04-9 MF: HOOC(CH2)4COOH Purity:99.

TDI: 1).HS: 2929101000 2).Packing: 250kg Iron Drums, 20mt in 20'FCL 3).CAS: 584-84-9 4).Chemical Fo

1.Name: Copper Sulphate(Copper sulfate, Cupric sulfate) MF: CuSO45H2O Appearance: Blue Crystal Granule 2.Pu